C21H22ClN3O5 — CID 139320475
[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-aminopyridine-3-carboxylate (PubChem CID 139320475) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-aminopyridine-3-carboxylate.
| Compound Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-aminopyridine-3-carboxylate |
|---|---|
| PubChem CID | 139320475 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 2-aminopyridine-3-carboxylate |
| SMILES | CN(C(=O)OCOC(=O)c1cccnc1N)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C21H22ClN3O5/c1-25(20(28)30-13-29-19(27)14-7-6-12-24-18(14)23)21(11-5-4-10-17(21)26)15-8-2-3-9-16(15)22/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H2,23,24)/t21-/m0/s1 |
| InChIKey | LUHZRPFODFMKKH-NRFANRHFSA-N |
| XLogP | 3.54 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|