C22H23ClN2O5 — CID 139320491
[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-methylpyridine-3-carboxylate (PubChem CID 139320491) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-methylpyridine-3-carboxylate.
| Compound Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 139320491 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl 4-methylpyridine-3-carboxylate |
| SMILES | Cc1ccncc1C(=O)OCOC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C22H23ClN2O5/c1-15-10-12-24-13-16(15)20(27)29-14-30-21(28)25(2)22(11-6-5-9-19(22)26)17-7-3-4-8-18(17)23/h3-4,7-8,10,12-13H,5-6,9,11,14H2,1-2H3/t22-/m0/s1 |
| InChIKey | MWQSFHFDZFHCQL-QFIPXVFZSA-N |
| XLogP | 4.26 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|