C21H24ClN2O3+ — CID 166087007
(3-methylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate (PubChem CID 166087007) has the molecular formula C21H24ClN2O3+ and a molecular weight of 387.89 g/mol. Its IUPAC name is (3-methylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate.
| Compound Name | (3-methylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166087007 |
| Molecular Formula | C21H24ClN2O3+ |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (3-methylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
| SMILES | Cc1ccc[n+](COC(=O)N(C)C2(c3ccccc3Cl)CCCCC2=O)c1 |
| InChI | InChI=1S/C21H24ClN2O3/c1-16-8-7-13-24(14-16)15-27-20(26)23(2)21(12-6-5-11-19(21)25)17-9-3-4-10-18(17)22/h3-4,7-10,13-14H,5-6,11-12,15H2,1-2H3/q+1 |
| InChIKey | FJKUXSPILOATGV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|