C21H26ClN2O2+ — CID 166087049
2-(2-chlorophenyl)-2-[methyl-[(4-methylpyridin-1-ium-1-yl)methoxymethyl]amino]cyclohexan-1-one (PubChem CID 166087049) has the molecular formula C21H26ClN2O2+ and a molecular weight of 373.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[methyl-[(4-methylpyridin-1-ium-1-yl)methoxymethyl]amino]cyclohexan-1-one.
| Compound Name | 2-(2-chlorophenyl)-2-[methyl-[(4-methylpyridin-1-ium-1-yl)methoxymethyl]amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 166087049 |
| Molecular Formula | C21H26ClN2O2+ |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[methyl-[(4-methylpyridin-1-ium-1-yl)methoxymethyl]amino]cyclohexan-1-one |
| SMILES | Cc1cc[n+](COCN(C)C2(c3ccccc3Cl)CCCCC2=O)cc1 |
| InChI | InChI=1S/C21H26ClN2O2/c1-17-10-13-24(14-11-17)16-26-15-23(2)21(12-6-5-9-20(21)25)18-7-3-4-8-19(18)22/h3-4,7-8,10-11,13-14H,5-6,9,12,15-16H2,1-2H3/q+1 |
| InChIKey | RUIZUHMJHWZPPZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|