C21H23ClN2OS — CID 23933608
1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-methylphenyl)thiourea (PubChem CID 23933608) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 23933608 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(C)C2(c3ccccc3Cl)CCCCC2=O)cc1 |
| InChI | InChI=1S/C21H23ClN2OS/c1-15-10-12-16(13-11-15)23-20(26)24(2)21(14-6-5-9-19(21)25)17-7-3-4-8-18(17)22/h3-4,7-8,10-13H,5-6,9,14H2,1-2H3,(H,23,26) |
| InChIKey | UTJXCXLIIQUDFW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|