C17H22ClNO3 — CID 163956305
ethyl 2-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]acetate (PubChem CID 163956305) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is ethyl 2-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]acetate |
|---|---|
| PubChem CID | 163956305 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl 2-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C17H22ClNO3/c1-3-22-16(21)12-19(2)17(11-7-6-10-15(17)20)13-8-4-5-9-14(13)18/h4-5,8-9H,3,6-7,10-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | SDRCHXSQWVEXKZ-QGZVFWFLSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |