C17H22ClNO3 — CID 170263505
propan-2-yl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate (PubChem CID 170263505) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is propan-2-yl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate.
| Compound Name | propan-2-yl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170263505 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | propan-2-yl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
| SMILES | CC(C)OC(=O)N(C)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C17H22ClNO3/c1-12(2)22-16(21)19(3)17(11-7-6-10-15(17)20)13-8-4-5-9-14(13)18/h4-5,8-9,12H,6-7,10-11H2,1-3H3 |
| InChIKey | GIZHSWMZGVXTKQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |