C24H33ClN2O6 — CID 146200836
1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 2-acetamido-3-methylpentanoate (PubChem CID 146200836) has the molecular formula C24H33ClN2O6 and a molecular weight of 480.99 g/mol. Its IUPAC name is 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 2-acetamido-3-methylpentanoate.
| Compound Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 2-acetamido-3-methylpentanoate |
|---|---|
| PubChem CID | 146200836 |
| Molecular Formula | C24H33ClN2O6 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyethyl 2-acetamido-3-methylpentanoate |
| SMILES | CCC(C)C(NC(C)=O)C(=O)OC(C)OC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C24H33ClN2O6/c1-6-15(2)21(26-16(3)28)22(30)32-17(4)33-23(31)27(5)24(14-10-9-13-20(24)29)18-11-7-8-12-19(18)25/h7-8,11-12,15,17,21H,6,9-10,13-14H2,1-5H3,(H,26,28)/t15?,17?,21?,24-/m0/s1 |
| InChIKey | SYGUROFSATUOSA-HCSHYQKKSA-N |
| XLogP | 4.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|