C23H31ClN2O6 — CID 152595035
1-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl (2S)-2-acetamido-3-methylbutanoate (PubChem CID 152595035) has the molecular formula C23H31ClN2O6 and a molecular weight of 466.96 g/mol. Its IUPAC name is 1-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl (2S)-2-acetamido-3-methylbutanoate.
| Compound Name | 1-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl (2S)-2-acetamido-3-methylbutanoate |
|---|---|
| PubChem CID | 152595035 |
| Molecular Formula | C23H31ClN2O6 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-[[(1R)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl (2S)-2-acetamido-3-methylbutanoate |
| SMILES | CC(=O)N[C@H](C(=O)OC(C)OC(=O)NC[C@]1(c2ccccc2Cl)CCCCC1=O)C(C)C |
| InChI | InChI=1S/C23H31ClN2O6/c1-14(2)20(26-15(3)27)21(29)31-16(4)32-22(30)25-13-23(12-8-7-11-19(23)28)17-9-5-6-10-18(17)24/h5-6,9-10,14,16,20H,7-8,11-13H2,1-4H3,(H,25,30)(H,26,27)/t16?,20-,23-/m0/s1 |
| InChIKey | YWGYKUCFUWJAES-JNPFFFAESA-N |
| XLogP | 3.50 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|