C15H18Cl2N2O2 — CID 155755176
2-(chloroamino)-N-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methyl]acetamide (PubChem CID 155755176) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-(chloroamino)-N-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methyl]acetamide.
| Compound Name | 2-(chloroamino)-N-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 155755176 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-(chloroamino)-N-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methyl]acetamide |
| SMILES | O=C(CNCl)NC[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C15H18Cl2N2O2/c16-12-6-2-1-5-11(12)15(8-4-3-7-13(15)20)10-18-14(21)9-19-17/h1-2,5-6,19H,3-4,7-10H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | GVTJPXSHOSAIDC-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|