C13H17Cl2NO — CID 117065469
2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride (PubChem CID 117065469) has the molecular formula C13H17Cl2NO and a molecular weight of 277.21 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 117065469 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(2-chlorophenyl)-2-(trideuteriomethylamino)cyclohexan-1-one;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])NC1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C13H16ClNO.ClH/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14;/h2-3,6-7,15H,4-5,8-9H2,1H3;1H/i1D3; |
| InChIKey | VCMGMSHEPQENPE-NIIDSAIPSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |