C12H15Cl2NO — CID 25195026
2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride (PubChem CID 25195026) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride.
| Compound Name | 2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 25195026 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride |
| SMILES | Cl.NC1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C12H14ClNO.ClH/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15;/h1-2,5-6H,3-4,7-8,14H2;1H |
| InChIKey | CLPOJGPBUGCUKT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |