C12H14ClNO — CID 71751218
2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one (PubChem CID 71751218) has the molecular formula C12H14ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one.
| Compound Name | 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 71751218 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-amino-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one |
| SMILES | [2H]c1c([2H])c([2H])c(C2(N)CCCCC2=O)c(Cl)c1[2H] |
| InChI | InChI=1S/C12H14ClNO/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15/h1-2,5-6H,3-4,7-8,14H2/i1D,2D,5D,6D |
| InChIKey | BEQZHFIKTBVCAU-NMRLXUNGSA-N |
| XLogP | 2.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |