C17H24Cl2N2O2 — CID 155671578
[4-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylamino]-4-oxobutyl]azanium chloride (PubChem CID 155671578) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is [4-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylamino]-4-oxobutyl]azanium chloride.
| Compound Name | [4-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylamino]-4-oxobutyl]azanium chloride |
|---|---|
| PubChem CID | 155671578 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [4-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylamino]-4-oxobutyl]azanium chloride |
| SMILES | [Cl-].[NH3+]CCCC(=O)NC[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C17H23ClN2O2.ClH/c18-14-7-2-1-6-13(14)17(10-4-3-8-15(17)21)12-20-16(22)9-5-11-19;/h1-2,6-7H,3-5,8-12,19H2,(H,20,22);1H/t17-;/m1./s1 |
| InChIKey | LWLDXOABQIMPNY-UNTBIKODSA-N |
| XLogP | -1.14 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |