C20H28ClNO3 — CID 174964875
[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino] octanoate (PubChem CID 174964875) has the molecular formula C20H28ClNO3 and a molecular weight of 365.90 g/mol. Its IUPAC name is [[1-(2-chlorophenyl)-2-oxocyclohexyl]amino] octanoate.
| Compound Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]amino] octanoate |
|---|---|
| PubChem CID | 174964875 |
| Molecular Formula | C20H28ClNO3 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]amino] octanoate |
| SMILES | CCCCCCCC(=O)ONC1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H28ClNO3/c1-2-3-4-5-6-14-19(24)25-22-20(15-10-9-13-18(20)23)16-11-7-8-12-17(16)21/h7-8,11-12,22H,2-6,9-10,13-15H2,1H3 |
| InChIKey | IQEXRQSZRHTSOP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|