C21H27ClN2O6 — CID 151246928
1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(propanoylamino)acetate (PubChem CID 151246928) has the molecular formula C21H27ClN2O6 and a molecular weight of 438.91 g/mol. Its IUPAC name is 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(propanoylamino)acetate.
| Compound Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(propanoylamino)acetate |
|---|---|
| PubChem CID | 151246928 |
| Molecular Formula | C21H27ClN2O6 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(propanoylamino)acetate |
| SMILES | CCC(=O)NCC(=O)OC(C)OC(=O)NC[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C21H27ClN2O6/c1-3-18(26)23-12-19(27)29-14(2)30-20(28)24-13-21(11-7-6-10-17(21)25)15-8-4-5-9-16(15)22/h4-5,8-9,14H,3,6-7,10-13H2,1-2H3,(H,23,26)(H,24,28)/t14?,21-/m1/s1 |
| InChIKey | NRMRFGWXFQKIET-OKKPIIHCSA-N |
| XLogP | 2.86 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|