C20H25ClN2O6 — CID 175475632
[carbamoyloxy-[1-(2-chlorophenyl)-2-oxocyclohexyl]methyl] 2-(2-methylpropanoylamino)acetate (PubChem CID 175475632) has the molecular formula C20H25ClN2O6 and a molecular weight of 424.88 g/mol. Its IUPAC name is [carbamoyloxy-[1-(2-chlorophenyl)-2-oxocyclohexyl]methyl] 2-(2-methylpropanoylamino)acetate.
| Compound Name | [carbamoyloxy-[1-(2-chlorophenyl)-2-oxocyclohexyl]methyl] 2-(2-methylpropanoylamino)acetate |
|---|---|
| PubChem CID | 175475632 |
| Molecular Formula | C20H25ClN2O6 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [carbamoyloxy-[1-(2-chlorophenyl)-2-oxocyclohexyl]methyl] 2-(2-methylpropanoylamino)acetate |
| SMILES | CC(C)C(=O)NCC(=O)OC(OC(N)=O)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H25ClN2O6/c1-12(2)17(26)23-11-16(25)28-18(29-19(22)27)20(10-6-5-9-15(20)24)13-7-3-4-8-14(13)21/h3-4,7-8,12,18H,5-6,9-11H2,1-2H3,(H2,22,27)(H,23,26) |
| InChIKey | KHRGPLCWCPDMDS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|