C22H29ClN2O6 — CID 151732696
1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(2-methylpropanoylamino)acetate (PubChem CID 151732696) has the molecular formula C22H29ClN2O6 and a molecular weight of 452.94 g/mol. Its IUPAC name is 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(2-methylpropanoylamino)acetate.
| Compound Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(2-methylpropanoylamino)acetate |
|---|---|
| PubChem CID | 151732696 |
| Molecular Formula | C22H29ClN2O6 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxy]ethyl 2-(2-methylpropanoylamino)acetate |
| SMILES | CC(OC(=O)CNC(=O)C(C)C)OC(=O)NC[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C22H29ClN2O6/c1-14(2)20(28)24-12-19(27)30-15(3)31-21(29)25-13-22(11-7-6-10-18(22)26)16-8-4-5-9-17(16)23/h4-5,8-9,14-15H,6-7,10-13H2,1-3H3,(H,24,28)(H,25,29)/t15?,22-/m1/s1 |
| InChIKey | RKWQZIGYBMULAU-ZZAPORBBSA-N |
| XLogP | 3.11 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|