C19H20ClF3N2O6 — CID 152729596
[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxymethyl 2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 152729596) has the molecular formula C19H20ClF3N2O6 and a molecular weight of 464.82 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxymethyl 2-[(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | [(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxymethyl 2-[(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 152729596 |
| Molecular Formula | C19H20ClF3N2O6 |
| Molecular Weight | 464.82 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]methylcarbamoyloxymethyl 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | O=C(CNC(=O)C(F)(F)F)OCOC(=O)NC[C@@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C19H20ClF3N2O6/c20-13-6-2-1-5-12(13)18(8-4-3-7-14(18)26)10-25-17(29)31-11-30-15(27)9-24-16(28)19(21,22)23/h1-2,5-6H,3-4,7-11H2,(H,24,28)(H,25,29)/t18-/m1/s1 |
| InChIKey | ZXIGDCSZSFKCCR-GOSISDBHSA-N |
| XLogP | 2.63 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|