C20H25ClN2O6 — CID 146651319
[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S)-2-acetamidopropanoate (PubChem CID 146651319) has the molecular formula C20H25ClN2O6 and a molecular weight of 424.88 g/mol. Its IUPAC name is [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S)-2-acetamidopropanoate.
| Compound Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S)-2-acetamidopropanoate |
|---|---|
| PubChem CID | 146651319 |
| Molecular Formula | C20H25ClN2O6 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl (2S)-2-acetamidopropanoate |
| SMILES | CC(=O)N[C@@H](C)C(=O)OCOC(=O)N(C)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H25ClN2O6/c1-13(22-14(2)24)18(26)28-12-29-19(27)23(3)20(11-7-6-10-17(20)25)15-8-4-5-9-16(15)21/h4-5,8-9,13H,6-7,10-12H2,1-3H3,(H,22,24)/t13-,20?/m0/s1 |
| InChIKey | HTAWVFMEDLPYIL-SZQRVLIRSA-N |
| XLogP | 2.77 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|