C22H28ClNO6 — CID 159952655
1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxypropyl 4-oxopentanoate (PubChem CID 159952655) has the molecular formula C22H28ClNO6 and a molecular weight of 437.92 g/mol. Its IUPAC name is 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxypropyl 4-oxopentanoate.
| Compound Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxypropyl 4-oxopentanoate |
|---|---|
| PubChem CID | 159952655 |
| Molecular Formula | C22H28ClNO6 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxypropyl 4-oxopentanoate |
| SMILES | CCC(OC(=O)CCC(C)=O)OC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C22H28ClNO6/c1-4-20(29-19(27)13-12-15(2)25)30-21(28)24(3)22(14-8-7-11-18(22)26)16-9-5-6-10-17(16)23/h5-6,9-10,20H,4,7-8,11-14H2,1-3H3/t20?,22-/m0/s1 |
| InChIKey | LEELXSAKOJUDGY-IAXKEJLGSA-N |
| XLogP | 4.40 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|