C20H27ClN2O5 — CID 154983796
methyl (2S)-2-[[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyamino]-3-methylbutanoate (PubChem CID 154983796) has the molecular formula C20H27ClN2O5 and a molecular weight of 410.90 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 154983796 |
| Molecular Formula | C20H27ClN2O5 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl (2S)-2-[[[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxyamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NOC(=O)N(C)[C@]1(c2ccccc2Cl)CCCCC1=O)C(C)C |
| InChI | InChI=1S/C20H27ClN2O5/c1-13(2)17(18(25)27-4)22-28-19(26)23(3)20(12-8-7-11-16(20)24)14-9-5-6-10-15(14)21/h5-6,9-10,13,17,22H,7-8,11-12H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | USTMFUJXQNVNJJ-PXNSSMCTSA-N |
| XLogP | 3.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|