C23H27ClN2OS — CID 4269701
1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 4269701) has the molecular formula C23H27ClN2OS and a molecular weight of 415.00 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 4269701 |
| Molecular Formula | C23H27ClN2OS |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-2-oxocyclohexyl]-1-methyl-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)N(C)C2(c3ccccc3Cl)CCCCC2=O)cc1 |
| InChI | InChI=1S/C23H27ClN2OS/c1-16(2)17-11-13-18(14-12-17)25-22(28)26(3)23(15-7-6-10-21(23)27)19-8-4-5-9-20(19)24/h4-5,8-9,11-14,16H,6-7,10,15H2,1-3H3,(H,25,28) |
| InChIKey | AZAGSRPTHLVUMC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|