C26H36ClN4O3+ — CID 166087001
N-(5-aminopentyl)-1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxamide (PubChem CID 166087001) has the molecular formula C26H36ClN4O3+ and a molecular weight of 488.05 g/mol. Its IUPAC name is N-(5-aminopentyl)-1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | N-(5-aminopentyl)-1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 166087001 |
| Molecular Formula | C26H36ClN4O3+ |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-(5-aminopentyl)-1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxamide |
| SMILES | CN(COC[n+]1cccc(C(=O)NCCCCCN)c1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C26H35ClN4O3/c1-30(26(14-6-5-13-24(26)32)22-11-3-4-12-23(22)27)19-34-20-31-17-9-10-21(18-31)25(33)29-16-8-2-7-15-28/h3-4,9-12,17-18H,2,5-8,13-16,19-20,28H2,1H3/p+1 |
| InChIKey | BMBULLCNVVWJLE-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|