C22H26Cl2N3O4+ — CID 166087053
(3-carbamoylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate;chloromethane (PubChem CID 166087053) has the molecular formula C22H26Cl2N3O4+ and a molecular weight of 467.37 g/mol. Its IUPAC name is (3-carbamoylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate;chloromethane.
| Compound Name | (3-carbamoylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate;chloromethane |
|---|---|
| PubChem CID | 166087053 |
| Molecular Formula | C22H26Cl2N3O4+ |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (3-carbamoylpyridin-1-ium-1-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate;chloromethane |
| SMILES | CCl.CN(C(=O)OC[n+]1cccc(C(N)=O)c1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C21H22ClN3O4.CH3Cl/c1-24(20(28)29-14-25-12-6-7-15(13-25)19(23)27)21(11-5-4-10-18(21)26)16-8-2-3-9-17(16)22;1-2/h2-3,6-9,12-13H,4-5,10-11,14H2,1H3,(H-,23,27);1H3/p+1 |
| InChIKey | XVHFYYZSLZFCIN-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|