C27H39Cl2N6O3+ — CID 166087022
chloromethane;1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]-N-[4-(diaminomethylideneamino)butyl]pyridin-1-ium-3-carboxamide (PubChem CID 166087022) has the molecular formula C27H39Cl2N6O3+ and a molecular weight of 566.55 g/mol. Its IUPAC name is chloromethane;1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]-N-[4-(diaminomethylideneamino)butyl]pyridin-1-ium-3-carboxamide.
| Compound Name | chloromethane;1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]-N-[4-(diaminomethylideneamino)butyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 166087022 |
| Molecular Formula | C27H39Cl2N6O3+ |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | chloromethane;1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylamino]methoxymethyl]-N-[4-(diaminomethylideneamino)butyl]pyridin-1-ium-3-carboxamide |
| SMILES | CCl.CN(COC[n+]1cccc(C(=O)NCCCCN=C(N)N)c1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C26H35ClN6O3.CH3Cl/c1-32(26(13-5-4-12-23(26)34)21-10-2-3-11-22(21)27)18-36-19-33-16-8-9-20(17-33)24(35)30-14-6-7-15-31-25(28)29;1-2/h2-3,8-11,16-17H,4-7,12-15,18-19H2,1H3,(H4-,28,29,30,31,35);1H3/p+1 |
| InChIKey | FUIGOJOBCQUNHV-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|