C23H25ClN3O6+ — CID 166021702
2-[[1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]acetic acid (PubChem CID 166021702) has the molecular formula C23H25ClN3O6+ and a molecular weight of 474.92 g/mol. Its IUPAC name is 2-[[1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 166021702 |
| Molecular Formula | C23H25ClN3O6+ |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[[1-[[[1-(2-chlorophenyl)-2-oxocyclohexyl]-methylcarbamoyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]acetic acid |
| SMILES | CN(C(=O)OC[n+]1cccc(C(=O)NCC(=O)O)c1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C23H24ClN3O6/c1-26(23(11-5-4-10-19(23)28)17-8-2-3-9-18(17)24)22(32)33-15-27-12-6-7-16(14-27)21(31)25-13-20(29)30/h2-3,6-9,12,14H,4-5,10-11,13,15H2,1H3,(H-,25,29,30,31)/p+1 |
| InChIKey | MZFWSZRDBXFTEJ-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|