C24H29ClN2O4 — CID 55377267
N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylpropanamide (PubChem CID 55377267) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylpropanamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 55377267 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCN1C(=O)C2CCCCC2C1=O)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C24H29ClN2O4/c1-26(24(14-7-6-12-20(24)28)18-10-4-5-11-19(18)25)21(29)13-15-27-22(30)16-8-2-3-9-17(16)23(27)31/h4-5,10-11,16-17H,2-3,6-9,12-15H2,1H3 |
| InChIKey | DGNGARRLIWRTCK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|