C16H22N2O3 — CID 2848645
1-(azepan-1-yl)-2-[(4-methoxyphenyl)methylideneamino]oxyethanone (PubChem CID 2848645) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(4-methoxyphenyl)methylideneamino]oxyethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(4-methoxyphenyl)methylideneamino]oxyethanone |
|---|---|
| PubChem CID | 2848645 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(4-methoxyphenyl)methylideneamino]oxyethanone |
| SMILES | COc1ccc(C=NOCC(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-20-15-8-6-14(7-9-15)12-17-21-13-16(19)18-10-4-2-3-5-11-18/h6-9,12H,2-5,10-11,13H2,1H3 |
| InChIKey | UIJQPJLGIUNNPE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|