C18H26N2O3 — CID 78767129
1-(azepan-1-yl)-2-[(2-propan-2-yloxyphenyl)methylideneamino]oxyethanone (PubChem CID 78767129) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(2-propan-2-yloxyphenyl)methylideneamino]oxyethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(2-propan-2-yloxyphenyl)methylideneamino]oxyethanone |
|---|---|
| PubChem CID | 78767129 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(2-propan-2-yloxyphenyl)methylideneamino]oxyethanone |
| SMILES | CC(C)Oc1ccccc1C=NOCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-15(2)23-17-10-6-5-9-16(17)13-19-22-14-18(21)20-11-7-3-4-8-12-20/h5-6,9-10,13,15H,3-4,7-8,11-12,14H2,1-2H3 |
| InChIKey | VHTVBLYCZOUYRH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|