C15H20N2O2 — CID 56692418
1-(azepan-1-yl)-2-[(E)-benzylideneamino]oxyethanone (PubChem CID 56692418) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(E)-benzylideneamino]oxyethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(E)-benzylideneamino]oxyethanone |
|---|---|
| PubChem CID | 56692418 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(E)-benzylideneamino]oxyethanone |
| SMILES | O=C(CO/N=C/c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C15H20N2O2/c18-15(17-10-6-1-2-7-11-17)13-19-16-12-14-8-4-3-5-9-14/h3-5,8-9,12H,1-2,6-7,10-11,13H2/b16-12+ |
| InChIKey | RPIDOIMMKXLKBE-FOWTUZBSSA-N |
| XLogP | 2.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|