C19H26N4O3 — CID 24623645
4-(2-oxo-2-piperidin-1-ylethoxy)imino-N-phenylpiperidine-1-carboxamide (PubChem CID 24623645) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-(2-oxo-2-piperidin-1-ylethoxy)imino-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-(2-oxo-2-piperidin-1-ylethoxy)imino-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 24623645 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-(2-oxo-2-piperidin-1-ylethoxy)imino-N-phenylpiperidine-1-carboxamide |
| SMILES | O=C(CON=C1CCN(C(=O)Nc2ccccc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C19H26N4O3/c24-18(22-11-5-2-6-12-22)15-26-21-17-9-13-23(14-10-17)19(25)20-16-7-3-1-4-8-16/h1,3-4,7-8H,2,5-6,9-15H2,(H,20,25) |
| InChIKey | IVUDRCLNGXSCNQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|