C21H24N4O3S — CID 18209184
4-[2-(4-methylsulfanylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide (PubChem CID 18209184) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-[2-(4-methylsulfanylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-(4-methylsulfanylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 18209184 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-[2-(4-methylsulfanylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide |
| SMILES | CSc1ccc(NC(=O)CON=C2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-29-19-9-7-17(8-10-19)22-20(26)15-28-24-18-11-13-25(14-12-18)21(27)23-16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | MYHWNRWOORQNHE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|