C22H26N4O3 — CID 24623620
4-[2-(2,6-dimethylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide (PubChem CID 24623620) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-(2,6-dimethylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 24623620 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[2-(2,6-dimethylanilino)-2-oxoethoxy]imino-N-phenylpiperidine-1-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CON=C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-16-7-6-8-17(2)21(16)24-20(27)15-29-25-19-11-13-26(14-12-19)22(28)23-18-9-4-3-5-10-18/h3-10H,11-15H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | KGDZDULDEMWTBX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|