C23H28N4O3 — CID 18206718
4-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]imino-N-phenylpiperidine-1-carboxamide (PubChem CID 18206718) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]imino-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]imino-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 18206718 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[2-oxo-2-(4-propan-2-ylanilino)ethoxy]imino-N-phenylpiperidine-1-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)CON=C2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-17(2)18-8-10-20(11-9-18)24-22(28)16-30-26-21-12-14-27(15-13-21)23(29)25-19-6-4-3-5-7-19/h3-11,17H,12-16H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | UDTXZNPQFNTBRK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|