C18H31N3O3 — CID 60522966
1-[4-[2-(azepan-1-yl)-2-oxoethoxy]iminopiperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 60522966) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[4-[2-(azepan-1-yl)-2-oxoethoxy]iminopiperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[2-(azepan-1-yl)-2-oxoethoxy]iminopiperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 60522966 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-[4-[2-(azepan-1-yl)-2-oxoethoxy]iminopiperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC(=NOCC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H31N3O3/c1-18(2,3)17(23)21-12-8-15(9-13-21)19-24-14-16(22)20-10-6-4-5-7-11-20/h4-14H2,1-3H3 |
| InChIKey | MOTQVKJPZSMGHL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|