About N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide
N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide (PubChem CID 144814886) has the molecular formula C15H25N3O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide.
Molecular Properties
| Compound Name | N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide |
| PubChem CID | 144814886 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide |
| SMILES | CN(C=O)[C@@H]1CCC/C(=N\OCC(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-17(12-19)14-7-5-6-13(10-14)16-21-11-15(20)18-8-3-2-4-9-18/h12,14H,2-11H2,1H3/b16-13+/t14-/m1/s1 |
| InChIKey | MXRQXAJVIAUYAF-LBFFYKKLSA-N |
| XLogP | 1.40 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide?
The IUPAC name of N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide (CID 144814886) is N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide.
What is the SMILES notation for N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide?
The canonical SMILES for N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide is CN(C=O)[C@@H]1CCC/C(=N\OCC(=O)N2CCCCC2)C1.
What is the InChIKey of N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide?
The InChIKey is MXRQXAJVIAUYAF-LBFFYKKLSA-N. The full InChI is InChI=1S/C15H25N3O3/c1-17(12-19)14-7-5-6-13(10-14)16-21-11-15(20)18-8-3-2-4-9-18/h12,14H,2-11H2,1H3/b16-13+/t14-/m1/s1.
What are the key properties of N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide?
N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide has a molecular weight of 295.38 g/mol, XLogP of 1.40, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide is sourced from PubChem (CID 144814886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).