C15H25N3O3 — CID 144814886
N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide (PubChem CID 144814886) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide.
| Compound Name | N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide |
|---|---|
| PubChem CID | 144814886 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-methyl-N-[(1R,3E)-3-(2-oxo-2-piperidin-1-ylethoxy)iminocyclohexyl]formamide |
| SMILES | CN(C=O)[C@@H]1CCC/C(=N\OCC(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-17(12-19)14-7-5-6-13(10-14)16-21-11-15(20)18-8-3-2-4-9-18/h12,14H,2-11H2,1H3/b16-13+/t14-/m1/s1 |
| InChIKey | MXRQXAJVIAUYAF-LBFFYKKLSA-N |
| XLogP | 1.40 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|