About piperidine-1-carboxylic acid;styrene
piperidine-1-carboxylic acid;styrene (PubChem CID 174300067) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is piperidine-1-carboxylic acid;styrene.
Molecular Properties
| Compound Name | piperidine-1-carboxylic acid;styrene |
| PubChem CID | 174300067 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | piperidine-1-carboxylic acid;styrene |
| SMILES | C=Cc1ccccc1.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C8H8.C6H11NO2/c1-2-8-6-4-3-5-7-8;8-6(9)7-4-2-1-3-5-7/h2-7H,1H2;1-5H2,(H,8,9) |
| InChIKey | XEGJQRCZVYPXRC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze piperidine-1-carboxylic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1-carboxylic acid;styrene?
The IUPAC name of piperidine-1-carboxylic acid;styrene (CID 174300067) is piperidine-1-carboxylic acid;styrene.
What is the SMILES notation for piperidine-1-carboxylic acid;styrene?
The canonical SMILES for piperidine-1-carboxylic acid;styrene is C=Cc1ccccc1.O=C(O)N1CCCCC1.
What is the InChIKey of piperidine-1-carboxylic acid;styrene?
The InChIKey is XEGJQRCZVYPXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H11NO2/c1-2-8-6-4-3-5-7-8;8-6(9)7-4-2-1-3-5-7/h2-7H,1H2;1-5H2,(H,8,9).
What are the key properties of piperidine-1-carboxylic acid;styrene?
piperidine-1-carboxylic acid;styrene has a molecular weight of 233.31 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carboxylic acid;styrene is sourced from PubChem (CID 174300067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).