About ethenylphosphonic acid;styrene
ethenylphosphonic acid;styrene (PubChem CID 67019440) has the molecular formula C10H13O3P
and a molecular weight of 212.18 g/mol. Its IUPAC name is ethenylphosphonic acid;styrene.
Molecular Properties
| Compound Name | ethenylphosphonic acid;styrene |
| PubChem CID | 67019440 |
| Molecular Formula | C10H13O3P |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | ethenylphosphonic acid;styrene |
| SMILES | C=CP(=O)(O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C2H5O3P/c1-2-8-6-4-3-5-7-8;1-2-6(3,4)5/h2-7H,1H2;2H,1H2,(H2,3,4,5) |
| InChIKey | WGHBNOMBALDVKL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethenylphosphonic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylphosphonic acid;styrene?
The IUPAC name of ethenylphosphonic acid;styrene (CID 67019440) is ethenylphosphonic acid;styrene.
What is the SMILES notation for ethenylphosphonic acid;styrene?
The canonical SMILES for ethenylphosphonic acid;styrene is C=CP(=O)(O)O.C=Cc1ccccc1.
What is the InChIKey of ethenylphosphonic acid;styrene?
The InChIKey is WGHBNOMBALDVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C2H5O3P/c1-2-8-6-4-3-5-7-8;1-2-6(3,4)5/h2-7H,1H2;2H,1H2,(H2,3,4,5).
What are the key properties of ethenylphosphonic acid;styrene?
ethenylphosphonic acid;styrene has a molecular weight of 212.18 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylphosphonic acid;styrene is sourced from PubChem (CID 67019440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).