About prop-1-en-2-ylphosphonic acid;styrene
prop-1-en-2-ylphosphonic acid;styrene (PubChem CID 160761452) has the molecular formula C11H15O3P
and a molecular weight of 226.21 g/mol. Its IUPAC name is prop-1-en-2-ylphosphonic acid;styrene.
Molecular Properties
| Compound Name | prop-1-en-2-ylphosphonic acid;styrene |
| PubChem CID | 160761452 |
| Molecular Formula | C11H15O3P |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | prop-1-en-2-ylphosphonic acid;styrene |
| SMILES | C=C(C)P(=O)(O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C3H7O3P/c1-2-8-6-4-3-5-7-8;1-3(2)7(4,5)6/h2-7H,1H2;1H2,2H3,(H2,4,5,6) |
| InChIKey | RYCWIOXIGZKNTA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-ylphosphonic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-ylphosphonic acid;styrene?
The IUPAC name of prop-1-en-2-ylphosphonic acid;styrene (CID 160761452) is prop-1-en-2-ylphosphonic acid;styrene.
What is the SMILES notation for prop-1-en-2-ylphosphonic acid;styrene?
The canonical SMILES for prop-1-en-2-ylphosphonic acid;styrene is C=C(C)P(=O)(O)O.C=Cc1ccccc1.
What is the InChIKey of prop-1-en-2-ylphosphonic acid;styrene?
The InChIKey is RYCWIOXIGZKNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C3H7O3P/c1-2-8-6-4-3-5-7-8;1-3(2)7(4,5)6/h2-7H,1H2;1H2,2H3,(H2,4,5,6).
What are the key properties of prop-1-en-2-ylphosphonic acid;styrene?
prop-1-en-2-ylphosphonic acid;styrene has a molecular weight of 226.21 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-ylphosphonic acid;styrene is sourced from PubChem (CID 160761452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).