C10H10F2N2O3 — CID 18292189
2-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]oxyacetamide (PubChem CID 18292189) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]oxyacetamide.
| Compound Name | 2-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 18292189 |
| Molecular Formula | C10H10F2N2O3 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]oxyacetamide |
| SMILES | NC(=O)CO/N=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C10H10F2N2O3/c11-10(12)17-8-4-2-1-3-7(8)5-14-16-6-9(13)15/h1-5,10H,6H2,(H2,13,15)/b14-5+ |
| InChIKey | JWGTUUNPNUBROR-LHHJGKSTSA-N |
| XLogP | 1.12 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|