C17H16F2N2O5S — CID 9353732
2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-(3-methylsulfonylphenyl)acetamide (PubChem CID 9353732) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-(3-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-(3-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9353732 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-(3-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)CO/N=C\c2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C17H16F2N2O5S/c1-27(23,24)14-7-4-6-13(9-14)21-16(22)11-25-20-10-12-5-2-3-8-15(12)26-17(18)19/h2-10,17H,11H2,1H3,(H,21,22)/b20-10- |
| InChIKey | MSFINFKXSGEKJC-JMIUGGIZSA-N |
| XLogP | 2.68 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|