C18H18F2N2O4 — CID 7644287
2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 7644287) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7644287 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)CO/N=C\c1ccccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O4/c1-24-15-8-4-2-6-13(15)10-21-17(23)12-25-22-11-14-7-3-5-9-16(14)26-18(19)20/h2-9,11,18H,10,12H2,1H3,(H,21,23)/b22-11- |
| InChIKey | ZISAVSIRTHQUAW-JJFYIABZSA-N |
| XLogP | 2.96 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|