C19H17FN2O3 — CID 35699920
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-methylbenzoate (PubChem CID 35699920) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-methylbenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 35699920 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N(CCC#N)c2ccccc2F)c1 |
| InChI | InChI=1S/C19H17FN2O3/c1-14-6-4-7-15(12-14)19(24)25-13-18(23)22(11-5-10-21)17-9-3-2-8-16(17)20/h2-4,6-9,12H,5,11,13H2,1H3 |
| InChIKey | MWPSILBFEPJNGG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |