C20H19FN2O4 — CID 35617640
[2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-(methoxymethyl)benzoate (PubChem CID 35617640) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-(methoxymethyl)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 35617640 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-2-fluoroanilino]-2-oxoethyl] 3-(methoxymethyl)benzoate |
| SMILES | COCc1cccc(C(=O)OCC(=O)N(CCC#N)c2ccccc2F)c1 |
| InChI | InChI=1S/C20H19FN2O4/c1-26-13-15-6-4-7-16(12-15)20(25)27-14-19(24)23(11-5-10-22)18-9-3-2-8-17(18)21/h2-4,6-9,12H,5,11,13-14H2,1H3 |
| InChIKey | ODNLNRYIOCZRQL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |