C25H22FN3O5S — CID 16520942
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate (PubChem CID 16520942) has the molecular formula C25H22FN3O5S and a molecular weight of 495.53 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16520942 |
| Molecular Formula | C25H22FN3O5S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-(benzylsulfamoyl)benzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cccc(S(=O)(=O)NCc2ccccc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FN3O5S/c26-21-10-12-22(13-11-21)29(15-5-14-27)24(30)18-34-25(31)20-8-4-9-23(16-20)35(32,33)28-17-19-6-2-1-3-7-19/h1-4,6-13,16,28H,5,15,17-18H2 |
| InChIKey | GZFGAOQDFSHWSA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |