C24H20FN3O5S — CID 2553214
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]benzoate (PubChem CID 2553214) has the molecular formula C24H20FN3O5S and a molecular weight of 481.51 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2553214 |
| Molecular Formula | C24H20FN3O5S |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]benzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccccc1NS(=O)(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20FN3O5S/c25-18-11-13-20(14-12-18)34(31,32)27-22-10-5-4-9-21(22)24(30)33-17-23(29)28(16-6-15-26)19-7-2-1-3-8-19/h1-5,7-14,27H,6,16-17H2 |
| InChIKey | GVCDRKCAPYAIHU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |