C26H25N3O5S — CID 41399072
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 41399072) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 41399072 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(C)c(C(=O)OCC(=O)N(CCC#N)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H25N3O5S/c1-19-8-6-9-21(16-19)28-35(32,33)23-13-12-20(2)24(17-23)26(31)34-18-25(30)29(15-7-14-27)22-10-4-3-5-11-22/h3-6,8-13,16-17,28H,7,15,18H2,1-2H3 |
| InChIKey | VFUWRJBNYFOUBX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |