C20H23N3O6S — CID 2631471
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 2631471) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2631471 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-5-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)Nc2cccc(C)c2)ccc1C |
| InChI | InChI=1S/C20H23N3O6S/c1-4-21-20(26)22-18(24)12-29-19(25)17-11-16(9-8-14(17)3)30(27,28)23-15-7-5-6-13(2)10-15/h5-11,23H,4,12H2,1-3H3,(H2,21,22,24,26) |
| InChIKey | XQELBIBMNLRBHH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |