C19H20N2O7S — CID 2706788
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 2706788) has the molecular formula C19H20N2O7S and a molecular weight of 420.44 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2706788 |
| Molecular Formula | C19H20N2O7S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cccc(S(=O)(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C19H20N2O7S/c1-3-27-19(24)20-17(22)12-28-18(23)14-7-5-9-16(11-14)29(25,26)21-15-8-4-6-13(2)10-15/h4-11,21H,3,12H2,1-2H3,(H,20,22,24) |
| InChIKey | IYKJXGROCSLXAL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |